C12H13N3O3S2 — CID 169358880
[4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea (PubChem CID 169358880) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is [4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea.
| Compound Name | [4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 169358880 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | [4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C12H13N3O3S2/c13-12(19)15-9-3-5-11(6-4-9)20(16,17)14-8-10-2-1-7-18-10/h1-7,14H,8H2,(H3,13,15,19) |
| InChIKey | FQJZSBAAFIURJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|