C19H23N3O4S2 — CID 17171044
N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]cyclohexanecarboxamide (PubChem CID 17171044) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17171044 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]cyclohexanecarboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H23N3O4S2/c23-18(14-5-2-1-3-6-14)22-19(27)21-15-8-10-17(11-9-15)28(24,25)20-13-16-7-4-12-26-16/h4,7-12,14,20H,1-3,5-6,13H2,(H2,21,22,23,27) |
| InChIKey | VCFXCUXFPRKVLM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|