C10H12N2O2S — CID 1243044
N-(furan-2-ylmethylcarbamothioyl)cyclopropanecarboxamide (PubChem CID 1243044) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamothioyl)cyclopropanecarboxamide.
| Compound Name | N-(furan-2-ylmethylcarbamothioyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 1243044 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | N-(furan-2-ylmethylcarbamothioyl)cyclopropanecarboxamide |
| SMILES | O=C(NC(=S)NCc1ccco1)C1CC1 |
| InChI | InChI=1S/C10H12N2O2S/c13-9(7-3-4-7)12-10(15)11-6-8-2-1-5-14-8/h1-2,5,7H,3-4,6H2,(H2,11,12,13,15) |
| InChIKey | DTAJBCLHJJCDSX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|