C11H16N2O2S — CID 17100622
N-(furan-2-ylmethylcarbamothioyl)-2,2-dimethylpropanamide (PubChem CID 17100622) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamothioyl)-2,2-dimethylpropanamide.
| Compound Name | N-(furan-2-ylmethylcarbamothioyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 17100622 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(furan-2-ylmethylcarbamothioyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(=S)NCc1ccco1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(2,3)9(14)13-10(16)12-7-8-5-4-6-15-8/h4-6H,7H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | SBECJSBTYORQFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|