C11H10N2O3S — CID 702076
N-(furan-2-ylmethylcarbamothioyl)furan-2-carboxamide (PubChem CID 702076) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(furan-2-ylmethylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 702076 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | N-(furan-2-ylmethylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)NCc1ccco1)c1ccco1 |
| InChI | InChI=1S/C11H10N2O3S/c14-10(9-4-2-6-16-9)13-11(17)12-7-8-3-1-5-15-8/h1-6H,7H2,(H2,12,13,14,17) |
| InChIKey | KLCUTYGLJDBNKU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|