C14H13FN2O2S — CID 3535012
N-[(5-fluoro-2-methylphenyl)methylcarbamothioyl]furan-2-carboxamide (PubChem CID 3535012) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[(5-fluoro-2-methylphenyl)methylcarbamothioyl]furan-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-methylphenyl)methylcarbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3535012 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-[(5-fluoro-2-methylphenyl)methylcarbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(F)cc1CNC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H13FN2O2S/c1-9-4-5-11(15)7-10(9)8-16-14(20)17-13(18)12-3-2-6-19-12/h2-7H,8H2,1H3,(H2,16,17,18,20) |
| InChIKey | GCNINECLTPCSGM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|