C9H10N2O2S — CID 2294785
N-(prop-2-enylcarbamothioyl)furan-2-carboxamide (PubChem CID 2294785) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is N-(prop-2-enylcarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(prop-2-enylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2294785 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | N-(prop-2-enylcarbamothioyl)furan-2-carboxamide |
| SMILES | C=CCNC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C9H10N2O2S/c1-2-5-10-9(14)11-8(12)7-4-3-6-13-7/h2-4,6H,1,5H2,(H2,10,11,12,14) |
| InChIKey | FDNUZLDUHDGEKV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|