C11H10Cl2N2OS — CID 17133810
3,5-dichloro-N-(prop-2-enylcarbamothioyl)benzamide (PubChem CID 17133810) has the molecular formula C11H10Cl2N2OS and a molecular weight of 289.19 g/mol. Its IUPAC name is 3,5-dichloro-N-(prop-2-enylcarbamothioyl)benzamide.
| Compound Name | 3,5-dichloro-N-(prop-2-enylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 17133810 |
| Molecular Formula | C11H10Cl2N2OS |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3,5-dichloro-N-(prop-2-enylcarbamothioyl)benzamide |
| SMILES | C=CCNC(=S)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2OS/c1-2-3-14-11(17)15-10(16)7-4-8(12)6-9(13)5-7/h2,4-6H,1,3H2,(H2,14,15,16,17) |
| InChIKey | XSKJXYZYWAPGIR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|