C9H7Cl2N3O2S — CID 150538307
N-(carbamoylcarbamothioyl)-3,5-dichlorobenzamide (PubChem CID 150538307) has the molecular formula C9H7Cl2N3O2S and a molecular weight of 292.15 g/mol. Its IUPAC name is N-(carbamoylcarbamothioyl)-3,5-dichlorobenzamide.
| Compound Name | N-(carbamoylcarbamothioyl)-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 150538307 |
| Molecular Formula | C9H7Cl2N3O2S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | N-(carbamoylcarbamothioyl)-3,5-dichlorobenzamide |
| SMILES | NC(=O)NC(=S)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2N3O2S/c10-5-1-4(2-6(11)3-5)7(15)13-9(17)14-8(12)16/h1-3H,(H4,12,13,14,15,16,17) |
| InChIKey | IFIFJLBSDYTCRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|