C18H19Cl2N3O3S2 — CID 17133783
N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3,5-dichlorobenzamide (PubChem CID 17133783) has the molecular formula C18H19Cl2N3O3S2 and a molecular weight of 460.41 g/mol. Its IUPAC name is N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3,5-dichlorobenzamide.
| Compound Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 17133783 |
| Molecular Formula | C18H19Cl2N3O3S2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3,5-dichlorobenzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O3S2/c1-18(2,3)23-28(25,26)15-6-4-14(5-7-15)21-17(27)22-16(24)11-8-12(19)10-13(20)9-11/h4-10,23H,1-3H3,(H2,21,22,24,27) |
| InChIKey | JQVAQSDAQWKLEP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|