C16H18BrN3O4S2 — CID 3255395
5-bromo-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 3255395) has the molecular formula C16H18BrN3O4S2 and a molecular weight of 460.38 g/mol. Its IUPAC name is 5-bromo-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3255395 |
| Molecular Formula | C16H18BrN3O4S2 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 5-bromo-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C16H18BrN3O4S2/c1-16(2,3)20-26(22,23)11-6-4-10(5-7-11)18-15(25)19-14(21)12-8-9-13(17)24-12/h4-9,20H,1-3H3,(H2,18,19,21,25) |
| InChIKey | JBSKEABQGPZWTB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|