C18H20IN3O3S2 — CID 3252743
N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-2-iodobenzamide (PubChem CID 3252743) has the molecular formula C18H20IN3O3S2 and a molecular weight of 517.41 g/mol. Its IUPAC name is N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 3252743 |
| Molecular Formula | C18H20IN3O3S2 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-2-iodobenzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C18H20IN3O3S2/c1-18(2,3)22-27(24,25)13-10-8-12(9-11-13)20-17(26)21-16(23)14-6-4-5-7-15(14)19/h4-11,22H,1-3H3,(H2,20,21,23,26) |
| InChIKey | FRUUSHBBBPQMLQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|