C24H25N3O3S2 — CID 3252740
N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-4-phenylbenzamide (PubChem CID 3252740) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 3252740 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-4-phenylbenzamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3S2/c1-24(2,3)27-32(29,30)21-15-13-20(14-16-21)25-23(31)26-22(28)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16,27H,1-3H3,(H2,25,26,28,31) |
| InChIKey | UHXWHULJNSMOIU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|