C21H18ClN3O3S2 — CID 141273722
2-chloro-N-[[4-[(4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 141273722) has the molecular formula C21H18ClN3O3S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 2-chloro-N-[[4-[(4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[[4-[(4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 141273722 |
| Molecular Formula | C21H18ClN3O3S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-chloro-N-[[4-[(4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3S2/c1-14-6-8-16(9-7-14)25-30(27,28)17-12-10-15(11-13-17)23-21(29)24-20(26)18-4-2-3-5-19(18)22/h2-13,25H,1H3,(H2,23,24,26,29) |
| InChIKey | AQBNRMPNAIICBQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|