C15H15ClN5O3S2+ — CID 7304437
[4-[(2-chlorobenzoyl)carbamothioylamino]phenyl]sulfonyl-(diaminomethylidene)azanium (PubChem CID 7304437) has the molecular formula C15H15ClN5O3S2+ and a molecular weight of 412.90 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)carbamothioylamino]phenyl]sulfonyl-(diaminomethylidene)azanium.
| Compound Name | [4-[(2-chlorobenzoyl)carbamothioylamino]phenyl]sulfonyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 7304437 |
| Molecular Formula | C15H15ClN5O3S2+ |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [4-[(2-chlorobenzoyl)carbamothioylamino]phenyl]sulfonyl-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClN5O3S2/c16-12-4-2-1-3-11(12)13(22)20-15(25)19-9-5-7-10(8-6-9)26(23,24)21-14(17)18/h1-8H,(H4,17,18,21)(H2,19,20,22,25)/p+1 |
| InChIKey | JOONYMHXWGXVMU-UHFFFAOYSA-O |
| XLogP | -0.49 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|