C15H14N4O5S — CID 5084186
2-[[4-(diaminomethylideneazaniumylsulfonyl)phenyl]carbamoyl]benzoate (PubChem CID 5084186) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-[[4-(diaminomethylideneazaniumylsulfonyl)phenyl]carbamoyl]benzoate.
| Compound Name | 2-[[4-(diaminomethylideneazaniumylsulfonyl)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 5084186 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[[4-(diaminomethylideneazaniumylsulfonyl)phenyl]carbamoyl]benzoate |
| SMILES | NC(N)=[NH+]S(=O)(=O)c1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N4O5S/c16-15(17)19-25(23,24)10-7-5-9(6-8-10)18-13(20)11-3-1-2-4-12(11)14(21)22/h1-8H,(H,18,20)(H,21,22)(H4,16,17,19) |
| InChIKey | PPSWCAGEPFPFQK-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 169.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|