C13H15N4O4S2+ — CID 7048923
[4-(benzenesulfonamido)phenyl]sulfonyl-(diaminomethylidene)azanium (PubChem CID 7048923) has the molecular formula C13H15N4O4S2+ and a molecular weight of 355.42 g/mol. Its IUPAC name is [4-(benzenesulfonamido)phenyl]sulfonyl-(diaminomethylidene)azanium.
| Compound Name | [4-(benzenesulfonamido)phenyl]sulfonyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 7048923 |
| Molecular Formula | C13H15N4O4S2+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | [4-(benzenesulfonamido)phenyl]sulfonyl-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]S(=O)(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C13H14N4O4S2/c14-13(15)17-23(20,21)12-8-6-10(7-9-12)16-22(18,19)11-4-2-1-3-5-11/h1-9,16H,(H4,14,15,17)/p+1 |
| InChIKey | DVOOVQJGFPBVPU-UHFFFAOYSA-O |
| XLogP | -1.47 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|