C18H16N2O4S2 — CID 8822463
4-N-(4-phenylphenyl)benzene-1,4-disulfonamide (PubChem CID 8822463) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-N-(4-phenylphenyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(4-phenylphenyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 8822463 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-N-(4-phenylphenyl)benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H16N2O4S2/c19-25(21,22)17-10-12-18(13-11-17)26(23,24)20-16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13,20H,(H2,19,21,22) |
| InChIKey | SXWYEHGVBUKWLD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |