C32H36N2O4S2 — CID 2486227
4-tert-butyl-N-[4-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]phenyl]benzenesulfonamide (PubChem CID 2486227) has the molecular formula C32H36N2O4S2 and a molecular weight of 576.78 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2486227 |
| Molecular Formula | C32H36N2O4S2 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 4-tert-butyl-N-[4-[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(-c3ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36N2O4S2/c1-31(2,3)25-11-19-29(20-12-25)39(35,36)33-27-15-7-23(8-16-27)24-9-17-28(18-10-24)34-40(37,38)30-21-13-26(14-22-30)32(4,5)6/h7-22,33-34H,1-6H3 |
| InChIKey | ISCZKPLEJYUBLL-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |