C18H20NO5S- — CID 6978471
2-[4-[(4-tert-butylphenyl)sulfonylamino]phenoxy]acetate (PubChem CID 6978471) has the molecular formula C18H20NO5S- and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[4-[(4-tert-butylphenyl)sulfonylamino]phenoxy]acetate.
| Compound Name | 2-[4-[(4-tert-butylphenyl)sulfonylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 6978471 |
| Molecular Formula | C18H20NO5S- |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[4-[(4-tert-butylphenyl)sulfonylamino]phenoxy]acetate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(OCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-18(2,3)13-4-10-16(11-5-13)25(22,23)19-14-6-8-15(9-7-14)24-12-17(20)21/h4-11,19H,12H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | IGJMLVNQBGCWEB-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |