C12H16NO5S- — CID 7321312
2-[4-(tert-butylsulfamoyl)phenoxy]acetate (PubChem CID 7321312) has the molecular formula C12H16NO5S- and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[4-(tert-butylsulfamoyl)phenoxy]acetate.
| Compound Name | 2-[4-(tert-butylsulfamoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 7321312 |
| Molecular Formula | C12H16NO5S- |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[4-(tert-butylsulfamoyl)phenoxy]acetate |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C12H17NO5S/c1-12(2,3)13-19(16,17)10-6-4-9(5-7-10)18-8-11(14)15/h4-7,13H,8H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | UIOOIMNETKRGMK-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |