C19H24N2O2S — CID 112980197
4-tert-butyl-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide (PubChem CID 112980197) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112980197 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-tert-butyl-N-[4-(prop-2-enylamino)phenyl]benzenesulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-5-14-20-16-8-10-17(11-9-16)21-24(22,23)18-12-6-15(7-13-18)19(2,3)4/h5-13,20-21H,1,14H2,2-4H3 |
| InChIKey | RDUAVHNCNGWZIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|