C12H14ClN3O4S2 — CID 132988288
2-amino-N-(4-sulfamoylphenyl)benzenesulfonamide;hydrochloride (PubChem CID 132988288) has the molecular formula C12H14ClN3O4S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-amino-N-(4-sulfamoylphenyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-amino-N-(4-sulfamoylphenyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 132988288 |
| Molecular Formula | C12H14ClN3O4S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-amino-N-(4-sulfamoylphenyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1S(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S2.ClH/c13-11-3-1-2-4-12(11)21(18,19)15-9-5-7-10(8-6-9)20(14,16)17;/h1-8,15H,13H2,(H2,14,16,17);1H |
| InChIKey | UHVXWYXSXNVGLE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|