C15H20N4O4S2 — CID 139292939
3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 139292939) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 139292939 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | Cc1c(N)c(C)c(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)c(C)c1N |
| InChI | InChI=1S/C15H20N4O4S2/c1-8-13(16)9(2)15(10(3)14(8)17)25(22,23)19-11-4-6-12(7-5-11)24(18,20)21/h4-7,19H,16-17H2,1-3H3,(H2,18,20,21) |
| InChIKey | LBVCKGJZOWZSQW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|