C32H44N8O6S3 — CID 159346284
3,5-diamino-N-[4-(dimethylamino)phenyl]-2,4,6-trimethylbenzenesulfonamide;3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 159346284) has the molecular formula C32H44N8O6S3 and a molecular weight of 732.96 g/mol. Its IUPAC name is 3,5-diamino-N-[4-(dimethylamino)phenyl]-2,4,6-trimethylbenzenesulfonamide;3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3,5-diamino-N-[4-(dimethylamino)phenyl]-2,4,6-trimethylbenzenesulfonamide;3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 159346284 |
| Molecular Formula | C32H44N8O6S3 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.25 |
| IUPAC Name | 3,5-diamino-N-[4-(dimethylamino)phenyl]-2,4,6-trimethylbenzenesulfonamide;3,5-diamino-2,4,6-trimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | Cc1c(N)c(C)c(S(=O)(=O)Nc2ccc(N(C)C)cc2)c(C)c1N.Cc1c(N)c(C)c(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)c(C)c1N |
| InChI | InChI=1S/C17H24N4O2S.C15H20N4O4S2/c1-10-15(18)11(2)17(12(3)16(10)19)24(22,23)20-13-6-8-14(9-7-13)21(4)5;1-8-13(16)9(2)15(10(3)14(8)17)25(22,23)19-11-4-6-12(7-5-11)24(18,20)21/h6-9,20H,18-19H2,1-5H3;4-7,19H,16-17H2,1-3H3,(H2,18,20,21) |
| InChIKey | LGTOLMGKPHLOCQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 259.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|