C13H19N5O2S — CID 105358431
3-amino-N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 105358431) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3-amino-N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105358431 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-amino-N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2ccc(N(C)C)cc2)c(N)nn1C |
| InChI | InChI=1S/C13H19N5O2S/c1-9-12(13(14)15-18(9)4)21(19,20)16-10-5-7-11(8-6-10)17(2)3/h5-8,16H,1-4H3,(H2,14,15) |
| InChIKey | XFPSZNVSSMBMQK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|