C11H12Cl2N4O2S — CID 105359031
3-amino-N-(2,6-dichlorophenyl)-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 105359031) has the molecular formula C11H12Cl2N4O2S and a molecular weight of 335.22 g/mol. Its IUPAC name is 3-amino-N-(2,6-dichlorophenyl)-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(2,6-dichlorophenyl)-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359031 |
| Molecular Formula | C11H12Cl2N4O2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-amino-N-(2,6-dichlorophenyl)-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2c(Cl)cccc2Cl)c(N)nn1C |
| InChI | InChI=1S/C11H12Cl2N4O2S/c1-6-10(11(14)15-17(6)2)20(18,19)16-9-7(12)4-3-5-8(9)13/h3-5,16H,1-2H3,(H2,14,15) |
| InChIKey | MJWZJFIQMCPMPO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |