C11H11F3N4O2S — CID 105358866
3-amino-1,5-dimethyl-N-(3,4,5-trifluorophenyl)pyrazole-4-sulfonamide (PubChem CID 105358866) has the molecular formula C11H11F3N4O2S and a molecular weight of 320.30 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(3,4,5-trifluorophenyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(3,4,5-trifluorophenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105358866 |
| Molecular Formula | C11H11F3N4O2S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(3,4,5-trifluorophenyl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2cc(F)c(F)c(F)c2)c(N)nn1C |
| InChI | InChI=1S/C11H11F3N4O2S/c1-5-10(11(15)16-18(5)2)21(19,20)17-6-3-7(12)9(14)8(13)4-6/h3-4,17H,1-2H3,(H2,15,16) |
| InChIKey | DUGBRTWVOBJPFX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|