C18H24N2O4S2 — CID 26951380
4-tert-butyl-2,6-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 26951380) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-2,6-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26951380 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-tert-butyl-2,6-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-12-10-14(18(3,4)5)11-13(2)17(12)26(23,24)20-15-6-8-16(9-7-15)25(19,21)22/h6-11,20H,1-5H3,(H2,19,21,22) |
| InChIKey | ZEPIEFWRZHBHJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |