C10H15KNO2S — CID 66748434
p-t-Butylbenzenesulfonamide potassium (PubChem CID 66748434) has the molecular formula C10H15KNO2S and a molecular weight of 252.40 g/mol.
| Compound Name | p-t-Butylbenzenesulfonamide potassium |
|---|---|
| PubChem CID | 66748434 |
| Molecular Formula | C10H15KNO2S |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(S(N)(=O)=O)cc1.[K] |
| InChI | InChI=1S/C10H15NO2S.K/c1-10(2,3)8-4-6-9(7-5-8)14(11,12)13;/h4-7H,1-3H3,(H2,11,12,13); |
| InChIKey | BJYATIGZOWMIHX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |