C9H13NO3S — CID 68722995
4-(2-hydroxypropan-2-yl)benzenesulfonamide (PubChem CID 68722995) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-hydroxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 68722995 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(2-hydroxypropan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H13NO3S/c1-9(2,11)7-3-5-8(6-4-7)14(10,12)13/h3-6,11H,1-2H3,(H2,10,12,13) |
| InChIKey | WXGQGFWMVYIVDI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |