About bis(4-methylbenzenesulfonamide);selane
bis(4-methylbenzenesulfonamide);selane (PubChem CID 173300479) has the molecular formula C14H20N2O4S2Se
and a molecular weight of 423.42 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonamide);selane.
Molecular Properties
| Compound Name | bis(4-methylbenzenesulfonamide);selane |
| PubChem CID | 173300479 |
| Molecular Formula | C14H20N2O4S2Se |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | bis(4-methylbenzenesulfonamide);selane |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1.Cc1ccc(S(N)(=O)=O)cc1.[SeH2] |
| InChI | InChI=1S/2C7H9NO2S.H2Se/c2*1-6-2-4-7(5-3-6)11(8,9)10;/h2*2-5H,1H3,(H2,8,9,10);1H2 |
| InChIKey | SXHHRNVUROHCMT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylbenzenesulfonamide);selane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylbenzenesulfonamide);selane?
The IUPAC name of bis(4-methylbenzenesulfonamide);selane (CID 173300479) is bis(4-methylbenzenesulfonamide);selane.
What is the SMILES notation for bis(4-methylbenzenesulfonamide);selane?
The canonical SMILES for bis(4-methylbenzenesulfonamide);selane is Cc1ccc(S(N)(=O)=O)cc1.Cc1ccc(S(N)(=O)=O)cc1.[SeH2].
What is the InChIKey of bis(4-methylbenzenesulfonamide);selane?
The InChIKey is SXHHRNVUROHCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9NO2S.H2Se/c2*1-6-2-4-7(5-3-6)11(8,9)10;/h2*2-5H,1H3,(H2,8,9,10);1H2.
What are the key properties of bis(4-methylbenzenesulfonamide);selane?
bis(4-methylbenzenesulfonamide);selane has a molecular weight of 423.42 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylbenzenesulfonamide);selane is sourced from PubChem (CID 173300479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).