C12H20N2O5S — CID 143044654
methanol;4-methylbenzenesulfonamide;4-oxobutanamide (PubChem CID 143044654) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is methanol;4-methylbenzenesulfonamide;4-oxobutanamide.
| Compound Name | methanol;4-methylbenzenesulfonamide;4-oxobutanamide |
|---|---|
| PubChem CID | 143044654 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methanol;4-methylbenzenesulfonamide;4-oxobutanamide |
| SMILES | CO.Cc1ccc(S(N)(=O)=O)cc1.NC(=O)CCC=O |
| InChI | InChI=1S/C7H9NO2S.C4H7NO2.CH4O/c1-6-2-4-7(5-3-6)11(8,9)10;5-4(7)2-1-3-6;1-2/h2-5H,1H3,(H2,8,9,10);3H,1-2H2,(H2,5,7);2H,1H3 |
| InChIKey | MMHJWJHSYWQNMX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|