About acetonitrile;4-methylbenzenesulfonamide
acetonitrile;4-methylbenzenesulfonamide (PubChem CID 67578872) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is acetonitrile;4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | acetonitrile;4-methylbenzenesulfonamide |
| PubChem CID | 67578872 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | acetonitrile;4-methylbenzenesulfonamide |
| SMILES | CC#N.Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H9NO2S.C2H3N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-3/h2-5H,1H3,(H2,8,9,10);1H3 |
| InChIKey | YDQXVVOADSTXRJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;4-methylbenzenesulfonamide?
The IUPAC name of acetonitrile;4-methylbenzenesulfonamide (CID 67578872) is acetonitrile;4-methylbenzenesulfonamide.
What is the SMILES notation for acetonitrile;4-methylbenzenesulfonamide?
The canonical SMILES for acetonitrile;4-methylbenzenesulfonamide is CC#N.Cc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of acetonitrile;4-methylbenzenesulfonamide?
The InChIKey is YDQXVVOADSTXRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.C2H3N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-3/h2-5H,1H3,(H2,8,9,10);1H3.
What are the key properties of acetonitrile;4-methylbenzenesulfonamide?
acetonitrile;4-methylbenzenesulfonamide has a molecular weight of 212.27 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;4-methylbenzenesulfonamide is sourced from PubChem (CID 67578872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).