About 4-aminobenzenesulfonamide;azanylidyneazanium
4-aminobenzenesulfonamide;azanylidyneazanium (PubChem CID 21219865) has the molecular formula C6H9N4O2S+
and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;azanylidyneazanium.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonamide;azanylidyneazanium |
| PubChem CID | 21219865 |
| Molecular Formula | C6H9N4O2S+ |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 4-aminobenzenesulfonamide;azanylidyneazanium |
| SMILES | N#[NH+].Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.N2/c7-5-1-3-6(4-2-5)11(8,9)10;1-2/h1-4H,7H2,(H2,8,9,10);/p+1 |
| InChIKey | SRYYRNOGOXQLEN-UHFFFAOYSA-O |
| XLogP | -1.80 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonamide;azanylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonamide;azanylidyneazanium?
The IUPAC name of 4-aminobenzenesulfonamide;azanylidyneazanium (CID 21219865) is 4-aminobenzenesulfonamide;azanylidyneazanium.
What is the SMILES notation for 4-aminobenzenesulfonamide;azanylidyneazanium?
The canonical SMILES for 4-aminobenzenesulfonamide;azanylidyneazanium is N#[NH+].Nc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-aminobenzenesulfonamide;azanylidyneazanium?
The InChIKey is SRYYRNOGOXQLEN-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O2S.N2/c7-5-1-3-6(4-2-5)11(8,9)10;1-2/h1-4H,7H2,(H2,8,9,10);/p+1.
What are the key properties of 4-aminobenzenesulfonamide;azanylidyneazanium?
4-aminobenzenesulfonamide;azanylidyneazanium has a molecular weight of 201.23 g/mol, XLogP of -1.80, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonamide;azanylidyneazanium is sourced from PubChem (CID 21219865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).