C8H13N3O3S — CID 175093651
acetamide;4-aminobenzenesulfonamide (PubChem CID 175093651) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is acetamide;4-aminobenzenesulfonamide.
| Compound Name | acetamide;4-aminobenzenesulfonamide |
|---|---|
| PubChem CID | 175093651 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | acetamide;4-aminobenzenesulfonamide |
| SMILES | CC(N)=O.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.C2H5NO/c7-5-1-3-6(4-2-5)11(8,9)10;1-2(3)4/h1-4H,7H2,(H2,8,9,10);1H3,(H2,3,4) |
| InChIKey | DJVGOZWVRHZXQR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|