C11H19N3O4S — CID 66808736
4-aminobenzenesulfonamide;(2S)-2-amino-3-methylbutanoic acid (PubChem CID 66808736) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;(2S)-2-amino-3-methylbutanoic acid.
| Compound Name | 4-aminobenzenesulfonamide;(2S)-2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66808736 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-aminobenzenesulfonamide;(2S)-2-amino-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.C5H11NO2/c7-5-1-3-6(4-2-5)11(8,9)10;1-3(2)4(6)5(7)8/h1-4H,7H2,(H2,8,9,10);3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | OSUMZCHHIRIEKW-VWMHFEHESA-N |
| XLogP | -0.03 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|