C6H8CaN2O2S — CID 159358457
CID 159358457 (PubChem CID 159358457) has the molecular formula C6H8CaN2O2S and a molecular weight of 212.29 g/mol.
| Compound Name | CID 159358457 |
|---|---|
| PubChem CID | 159358457 |
| Molecular Formula | C6H8CaN2O2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | — |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1.[Ca] |
| InChI | InChI=1S/C6H8N2O2S.Ca/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,7H2,(H2,8,9,10); |
| InChIKey | LIFLVBBBCMXQOQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|