About 4-aminobenzenesulfonamide;5-methylpyrimidine
4-aminobenzenesulfonamide;5-methylpyrimidine (PubChem CID 174451060) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;5-methylpyrimidine.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonamide;5-methylpyrimidine |
| PubChem CID | 174451060 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-aminobenzenesulfonamide;5-methylpyrimidine |
| SMILES | Cc1cncnc1.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.C5H6N2/c7-5-1-3-6(4-2-5)11(8,9)10;1-5-2-6-4-7-3-5/h1-4H,7H2,(H2,8,9,10);2-4H,1H3 |
| InChIKey | COCGHSVPEGEKAK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonamide;5-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonamide;5-methylpyrimidine?
The IUPAC name of 4-aminobenzenesulfonamide;5-methylpyrimidine (CID 174451060) is 4-aminobenzenesulfonamide;5-methylpyrimidine.
What is the SMILES notation for 4-aminobenzenesulfonamide;5-methylpyrimidine?
The canonical SMILES for 4-aminobenzenesulfonamide;5-methylpyrimidine is Cc1cncnc1.Nc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-aminobenzenesulfonamide;5-methylpyrimidine?
The InChIKey is COCGHSVPEGEKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.C5H6N2/c7-5-1-3-6(4-2-5)11(8,9)10;1-5-2-6-4-7-3-5/h1-4H,7H2,(H2,8,9,10);2-4H,1H3.
What are the key properties of 4-aminobenzenesulfonamide;5-methylpyrimidine?
4-aminobenzenesulfonamide;5-methylpyrimidine has a molecular weight of 266.33 g/mol, XLogP of 0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonamide;5-methylpyrimidine is sourced from PubChem (CID 174451060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).