C13H16N2O4S — CID 174437033
4-aminobenzenesulfonamide;3-methylbenzene-1,2-diol (PubChem CID 174437033) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;3-methylbenzene-1,2-diol.
| Compound Name | 4-aminobenzenesulfonamide;3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 174437033 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-aminobenzenesulfonamide;3-methylbenzene-1,2-diol |
| SMILES | Cc1cccc(O)c1O.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H8O2.C6H8N2O2S/c1-5-3-2-4-6(8)7(5)9;7-5-1-3-6(4-2-5)11(8,9)10/h2-4,8-9H,1H3;1-4H,7H2,(H2,8,9,10) |
| InChIKey | YRPPLXFWGLQJOL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|