3-methylbenzene-1,2-diol;oxalic acid

C9H10O6 — CID 174606670

IUPAC3-methylbenzene-1,2-diol;oxalic acid
SMILESCc1cccc(O)c1O.O=C(O)C(=O)O
InChIInChI=1S/C7H8O2.C2H2O4/c1-5-3-2-4-6(8)7(5)9;3-1(4)2(5)6/h2-4,8-9H,1H3;(H,3,4)(H,5,6)
InChIKeyVRUIGSCOLYYOGP-UHFFFAOYSA-N
MW214.17 g/mol
LogP0.56
Rot. Bonds

About 3-methylbenzene-1,2-diol;oxalic acid

3-methylbenzene-1,2-diol;oxalic acid (PubChem CID 174606670) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is 3-methylbenzene-1,2-diol;oxalic acid.

Molecular Properties

Compound Name3-methylbenzene-1,2-diol;oxalic acid
PubChem CID174606670
Molecular FormulaC9H10O6
Molecular Weight214.17 g/mol
Exact Mass214.05
IUPAC Name3-methylbenzene-1,2-diol;oxalic acid
SMILESCc1cccc(O)c1O.O=C(O)C(=O)O
InChIInChI=1S/C7H8O2.C2H2O4/c1-5-3-2-4-6(8)7(5)9;3-1(4)2(5)6/h2-4,8-9H,1H3;(H,3,4)(H,5,6)
InChIKeyVRUIGSCOLYYOGP-UHFFFAOYSA-N
XLogP0.56
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.17
LogP ≤ 50.56
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3-methylbenzene-1,2-diol;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbenzene-1,2-diol;oxalic acid?
The IUPAC name of 3-methylbenzene-1,2-diol;oxalic acid (CID 174606670) is 3-methylbenzene-1,2-diol;oxalic acid.
What is the SMILES notation for 3-methylbenzene-1,2-diol;oxalic acid?
The canonical SMILES for 3-methylbenzene-1,2-diol;oxalic acid is Cc1cccc(O)c1O.O=C(O)C(=O)O.
What is the InChIKey of 3-methylbenzene-1,2-diol;oxalic acid?
The InChIKey is VRUIGSCOLYYOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C2H2O4/c1-5-3-2-4-6(8)7(5)9;3-1(4)2(5)6/h2-4,8-9H,1H3;(H,3,4)(H,5,6).
What are the key properties of 3-methylbenzene-1,2-diol;oxalic acid?
3-methylbenzene-1,2-diol;oxalic acid has a molecular weight of 214.17 g/mol, XLogP of 0.56, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzene-1,2-diol;oxalic acid is sourced from PubChem (CID 174606670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).