C9H10O6 — CID 174606670
3-methylbenzene-1,2-diol;oxalic acid (PubChem CID 174606670) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is 3-methylbenzene-1,2-diol;oxalic acid.
| Compound Name | 3-methylbenzene-1,2-diol;oxalic acid |
|---|---|
| PubChem CID | 174606670 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-methylbenzene-1,2-diol;oxalic acid |
| SMILES | Cc1cccc(O)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H8O2.C2H2O4/c1-5-3-2-4-6(8)7(5)9;3-1(4)2(5)6/h2-4,8-9H,1H3;(H,3,4)(H,5,6) |
| InChIKey | VRUIGSCOLYYOGP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|