About hydrogen peroxide;2-hydroxy-3-methylbenzoic acid
hydrogen peroxide;2-hydroxy-3-methylbenzoic acid (PubChem CID 161037568) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is hydrogen peroxide;2-hydroxy-3-methylbenzoic acid.
Molecular Properties
| Compound Name | hydrogen peroxide;2-hydroxy-3-methylbenzoic acid |
| PubChem CID | 161037568 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | hydrogen peroxide;2-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1O.OO |
| InChI | InChI=1S/C8H8O3.H2O2/c1-5-3-2-4-6(7(5)9)8(10)11;1-2/h2-4,9H,1H3,(H,10,11);1-2H |
| InChIKey | UALLWGCUAIIVLE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-hydroxy-3-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-hydroxy-3-methylbenzoic acid?
The IUPAC name of hydrogen peroxide;2-hydroxy-3-methylbenzoic acid (CID 161037568) is hydrogen peroxide;2-hydroxy-3-methylbenzoic acid.
What is the SMILES notation for hydrogen peroxide;2-hydroxy-3-methylbenzoic acid?
The canonical SMILES for hydrogen peroxide;2-hydroxy-3-methylbenzoic acid is Cc1cccc(C(=O)O)c1O.OO.
What is the InChIKey of hydrogen peroxide;2-hydroxy-3-methylbenzoic acid?
The InChIKey is UALLWGCUAIIVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.H2O2/c1-5-3-2-4-6(7(5)9)8(10)11;1-2/h2-4,9H,1H3,(H,10,11);1-2H.
What are the key properties of hydrogen peroxide;2-hydroxy-3-methylbenzoic acid?
hydrogen peroxide;2-hydroxy-3-methylbenzoic acid has a molecular weight of 186.16 g/mol, XLogP of 1.42, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-hydroxy-3-methylbenzoic acid is sourced from PubChem (CID 161037568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).