C16H14Br2O4 — CID 167562654
2-bromobenzene-1,3-dicarboxylic acid;2-bromo-1,3-dimethylbenzene (PubChem CID 167562654) has the molecular formula C16H14Br2O4 and a molecular weight of 430.09 g/mol. Its IUPAC name is 2-bromobenzene-1,3-dicarboxylic acid;2-bromo-1,3-dimethylbenzene.
| Compound Name | 2-bromobenzene-1,3-dicarboxylic acid;2-bromo-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 167562654 |
| Molecular Formula | C16H14Br2O4 |
| Molecular Weight | 430.09 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | 2-bromobenzene-1,3-dicarboxylic acid;2-bromo-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1Br.O=C(O)c1cccc(C(=O)O)c1Br |
| InChI | InChI=1S/C8H5BrO4.C8H9Br/c9-6-4(7(10)11)2-1-3-5(6)8(12)13;1-6-4-3-5-7(2)8(6)9/h1-3H,(H,10,11)(H,12,13);3-5H,1-2H3 |
| InChIKey | DWCXKWUZOJAWLH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.09 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |