About 2-amino-3-methylbenzoic acid;azane
2-amino-3-methylbenzoic acid;azane (PubChem CID 69400013) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-amino-3-methylbenzoic acid;azane.
Molecular Properties
| Compound Name | 2-amino-3-methylbenzoic acid;azane |
| PubChem CID | 69400013 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-amino-3-methylbenzoic acid;azane |
| SMILES | Cc1cccc(C(=O)O)c1N.N |
| InChI | InChI=1S/C8H9NO2.H3N/c1-5-3-2-4-6(7(5)9)8(10)11;/h2-4H,9H2,1H3,(H,10,11);1H3 |
| InChIKey | DRDAXVHVZQHEPK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-methylbenzoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methylbenzoic acid;azane?
The IUPAC name of 2-amino-3-methylbenzoic acid;azane (CID 69400013) is 2-amino-3-methylbenzoic acid;azane.
What is the SMILES notation for 2-amino-3-methylbenzoic acid;azane?
The canonical SMILES for 2-amino-3-methylbenzoic acid;azane is Cc1cccc(C(=O)O)c1N.N.
What is the InChIKey of 2-amino-3-methylbenzoic acid;azane?
The InChIKey is DRDAXVHVZQHEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.H3N/c1-5-3-2-4-6(7(5)9)8(10)11;/h2-4H,9H2,1H3,(H,10,11);1H3.
What are the key properties of 2-amino-3-methylbenzoic acid;azane?
2-amino-3-methylbenzoic acid;azane has a molecular weight of 168.20 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methylbenzoic acid;azane is sourced from PubChem (CID 69400013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).