About bromo 2-amino-3-methylbenzoate
bromo 2-amino-3-methylbenzoate (PubChem CID 174426723) has the molecular formula C8H8BrNO2
and a molecular weight of 230.06 g/mol. Its IUPAC name is bromo 2-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | bromo 2-amino-3-methylbenzoate |
| PubChem CID | 174426723 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | bromo 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OBr)c1N |
| InChI | InChI=1S/C8H8BrNO2/c1-5-3-2-4-6(7(5)10)8(11)12-9/h2-4H,10H2,1H3 |
| InChIKey | OTBYFQSHXAGFBX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bromo 2-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo 2-amino-3-methylbenzoate?
The IUPAC name of bromo 2-amino-3-methylbenzoate (CID 174426723) is bromo 2-amino-3-methylbenzoate.
What is the SMILES notation for bromo 2-amino-3-methylbenzoate?
The canonical SMILES for bromo 2-amino-3-methylbenzoate is Cc1cccc(C(=O)OBr)c1N.
What is the InChIKey of bromo 2-amino-3-methylbenzoate?
The InChIKey is OTBYFQSHXAGFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c1-5-3-2-4-6(7(5)10)8(11)12-9/h2-4H,10H2,1H3.
What are the key properties of bromo 2-amino-3-methylbenzoate?
bromo 2-amino-3-methylbenzoate has a molecular weight of 230.06 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 2-amino-3-methylbenzoate is sourced from PubChem (CID 174426723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).