About 2-hydroxypropyl 2-amino-3-methylbenzoate
2-hydroxypropyl 2-amino-3-methylbenzoate (PubChem CID 65279683) has the molecular formula C11H15NO3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-hydroxypropyl 2-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 2-amino-3-methylbenzoate |
| PubChem CID | 65279683 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-hydroxypropyl 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(C)O)c1N |
| InChI | InChI=1S/C11H15NO3/c1-7-4-3-5-9(10(7)12)11(14)15-6-8(2)13/h3-5,8,13H,6,12H2,1-2H3 |
| InChIKey | DGKMTTQWAUTCDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 2-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 2-amino-3-methylbenzoate?
The IUPAC name of 2-hydroxypropyl 2-amino-3-methylbenzoate (CID 65279683) is 2-hydroxypropyl 2-amino-3-methylbenzoate.
What is the SMILES notation for 2-hydroxypropyl 2-amino-3-methylbenzoate?
The canonical SMILES for 2-hydroxypropyl 2-amino-3-methylbenzoate is Cc1cccc(C(=O)OCC(C)O)c1N.
What is the InChIKey of 2-hydroxypropyl 2-amino-3-methylbenzoate?
The InChIKey is DGKMTTQWAUTCDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-7-4-3-5-9(10(7)12)11(14)15-6-8(2)13/h3-5,8,13H,6,12H2,1-2H3.
What are the key properties of 2-hydroxypropyl 2-amino-3-methylbenzoate?
2-hydroxypropyl 2-amino-3-methylbenzoate has a molecular weight of 209.25 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 2-amino-3-methylbenzoate is sourced from PubChem (CID 65279683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).