About pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate
pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate (PubChem CID 62700152) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate |
| PubChem CID | 62700152 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCc2ncccn2)c1N |
| InChI | InChI=1S/C13H13N3O2/c1-9-4-2-5-10(12(9)14)13(17)18-8-11-15-6-3-7-16-11/h2-7H,8,14H2,1H3 |
| InChIKey | CGOJJTLFBSODPF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate?
The IUPAC name of pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate (CID 62700152) is pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate.
What is the SMILES notation for pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate?
The canonical SMILES for pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate is Cc1cccc(C(=O)OCc2ncccn2)c1N.
What is the InChIKey of pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate?
The InChIKey is CGOJJTLFBSODPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2/c1-9-4-2-5-10(12(9)14)13(17)18-8-11-15-6-3-7-16-11/h2-7H,8,14H2,1H3.
What are the key properties of pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate?
pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate has a molecular weight of 243.27 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-2-ylmethyl 2-amino-3-methylbenzoate is sourced from PubChem (CID 62700152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).