About iron;2-methylbenzoic acid
iron;2-methylbenzoic acid (PubChem CID 174483135) has the molecular formula C8H8FeO2
and a molecular weight of 191.99 g/mol. Its IUPAC name is iron;2-methylbenzoic acid.
Molecular Properties
| Compound Name | iron;2-methylbenzoic acid |
| PubChem CID | 174483135 |
| Molecular Formula | C8H8FeO2 |
| Molecular Weight | 191.99 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | iron;2-methylbenzoic acid |
| SMILES | Cc1ccccc1C(=O)O.[Fe] |
| InChI | InChI=1S/C8H8O2.Fe/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H,9,10); |
| InChIKey | DOESJBPDAPDFKF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.99 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-methylbenzoic acid?
The IUPAC name of iron;2-methylbenzoic acid (CID 174483135) is iron;2-methylbenzoic acid.
What is the SMILES notation for iron;2-methylbenzoic acid?
The canonical SMILES for iron;2-methylbenzoic acid is Cc1ccccc1C(=O)O.[Fe].
What is the InChIKey of iron;2-methylbenzoic acid?
The InChIKey is DOESJBPDAPDFKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.Fe/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H,9,10);.
What are the key properties of iron;2-methylbenzoic acid?
iron;2-methylbenzoic acid has a molecular weight of 191.99 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-methylbenzoic acid is sourced from PubChem (CID 174483135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).