About acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium
acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium (PubChem CID 88653757) has the molecular formula C10H13O3PPd
and a molecular weight of 318.61 g/mol. Its IUPAC name is acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium.
Molecular Properties
| Compound Name | acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium |
| PubChem CID | 88653757 |
| Molecular Formula | C10H13O3PPd |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium |
| SMILES | CC(=O)O.Cc1ccccc1C(=O)P.[Pd] |
| InChI | InChI=1S/C8H9OP.C2H4O2.Pd/c1-6-4-2-3-5-7(6)8(9)10;1-2(3)4;/h2-5H,10H2,1H3;1H3,(H,3,4); |
| InChIKey | JFIBLHYCYJGZQS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium?
The IUPAC name of acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium (CID 88653757) is acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium.
What is the SMILES notation for acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium?
The canonical SMILES for acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium is CC(=O)O.Cc1ccccc1C(=O)P.[Pd].
What is the InChIKey of acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium?
The InChIKey is JFIBLHYCYJGZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9OP.C2H4O2.Pd/c1-6-4-2-3-5-7(6)8(9)10;1-2(3)4;/h2-5H,10H2,1H3;1H3,(H,3,4);.
What are the key properties of acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium?
acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium has a molecular weight of 318.61 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2-methylphenyl)-phosphanylmethanone;palladium is sourced from PubChem (CID 88653757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).