About 1-(2-methylphenyl)ethanone;1-phenylethanone
1-(2-methylphenyl)ethanone;1-phenylethanone (PubChem CID 160893925) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-methylphenyl)ethanone;1-phenylethanone.
Molecular Properties
| Compound Name | 1-(2-methylphenyl)ethanone;1-phenylethanone |
| PubChem CID | 160893925 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(2-methylphenyl)ethanone;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CC(=O)c1ccccc1C |
| InChI | InChI=1S/C9H10O.C8H8O/c1-7-5-3-4-6-9(7)8(2)10;1-7(9)8-5-3-2-4-6-8/h3-6H,1-2H3;2-6H,1H3 |
| InChIKey | SOPWVGONQACTME-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-methylphenyl)ethanone;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylphenyl)ethanone;1-phenylethanone?
The IUPAC name of 1-(2-methylphenyl)ethanone;1-phenylethanone (CID 160893925) is 1-(2-methylphenyl)ethanone;1-phenylethanone.
What is the SMILES notation for 1-(2-methylphenyl)ethanone;1-phenylethanone?
The canonical SMILES for 1-(2-methylphenyl)ethanone;1-phenylethanone is CC(=O)c1ccccc1.CC(=O)c1ccccc1C.
What is the InChIKey of 1-(2-methylphenyl)ethanone;1-phenylethanone?
The InChIKey is SOPWVGONQACTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C8H8O/c1-7-5-3-4-6-9(7)8(2)10;1-7(9)8-5-3-2-4-6-8/h3-6H,1-2H3;2-6H,1H3.
What are the key properties of 1-(2-methylphenyl)ethanone;1-phenylethanone?
1-(2-methylphenyl)ethanone;1-phenylethanone has a molecular weight of 254.33 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylphenyl)ethanone;1-phenylethanone is sourced from PubChem (CID 160893925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).